C16H21ClN8 — CID 118308939
4-chloro-6,7-dimethyl-2-[1-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]imidazo[1,2-a][1,3,5]triazine (PubChem CID 118308939) has the molecular formula C16H21ClN8 and a molecular weight of 360.85 g/mol. Its IUPAC name is 4-chloro-6,7-dimethyl-2-[1-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]imidazo[1,2-a][1,3,5]triazine.
| Compound Name | 4-chloro-6,7-dimethyl-2-[1-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]imidazo[1,2-a][1,3,5]triazine |
|---|---|
| PubChem CID | 118308939 |
| Molecular Formula | C16H21ClN8 |
| Molecular Weight | 360.85 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-chloro-6,7-dimethyl-2-[1-(2-methyl-5-pyrrolidin-1-yl-1,2,4-triazol-3-yl)ethyl]imidazo[1,2-a][1,3,5]triazine |
| SMILES | Cc1nc2nc(C(C)c3nc(N4CCCC4)nn3C)nc(Cl)n2c1C |
| InChI | InChI=1S/C16H21ClN8/c1-9(13-21-16(22-23(13)4)24-7-5-6-8-24)12-19-14(17)25-11(3)10(2)18-15(25)20-12/h9H,5-8H2,1-4H3 |
| InChIKey | IJTPERZOJWJXLU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 77.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.85 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |