About N,N-dimethylformamide;sulfanylidenecadmium
N,N-dimethylformamide;sulfanylidenecadmium (PubChem CID 11830901) has the molecular formula C3H7CdNOS
and a molecular weight of 217.57 g/mol. Its IUPAC name is N,N-dimethylformamide;sulfanylidenecadmium.
Molecular Properties
| Compound Name | N,N-dimethylformamide;sulfanylidenecadmium |
| PubChem CID | 11830901 |
| Molecular Formula | C3H7CdNOS |
| Molecular Weight | 217.57 g/mol |
| Exact Mass | 218.93 |
| IUPAC Name | N,N-dimethylformamide;sulfanylidenecadmium |
| SMILES | CN(C)C=O.S=[Cd] |
| InChI | InChI=1S/C3H7NO.Cd.S/c1-4(2)3-5;;/h3H,1-2H3;; |
| InChIKey | DDBZTHXKERJNQW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.57 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;sulfanylidenecadmium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;sulfanylidenecadmium?
The IUPAC name of N,N-dimethylformamide;sulfanylidenecadmium (CID 11830901) is N,N-dimethylformamide;sulfanylidenecadmium.
What is the SMILES notation for N,N-dimethylformamide;sulfanylidenecadmium?
The canonical SMILES for N,N-dimethylformamide;sulfanylidenecadmium is CN(C)C=O.S=[Cd].
What is the InChIKey of N,N-dimethylformamide;sulfanylidenecadmium?
The InChIKey is DDBZTHXKERJNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.Cd.S/c1-4(2)3-5;;/h3H,1-2H3;;.
What are the key properties of N,N-dimethylformamide;sulfanylidenecadmium?
N,N-dimethylformamide;sulfanylidenecadmium has a molecular weight of 217.57 g/mol, XLogP of 0.35, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;sulfanylidenecadmium is sourced from PubChem (CID 11830901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).