C10H18F3N3O3S — CID 118309676
2-(2,3-dimethyl-1H-imidazol-3-ium-4-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate (PubChem CID 118309676) has the molecular formula C10H18F3N3O3S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1H-imidazol-3-ium-4-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate.
| Compound Name | 2-(2,3-dimethyl-1H-imidazol-3-ium-4-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118309676 |
| Molecular Formula | C10H18F3N3O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-(2,3-dimethyl-1H-imidazol-3-ium-4-yl)-N,N-dimethylethanamine;trifluoromethanesulfonate |
| SMILES | Cc1[nH]cc(CCN(C)C)[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H17N3.CHF3O3S/c1-8-10-7-9(12(8)4)5-6-11(2)3;2-1(3,4)8(5,6)7/h7H,5-6H2,1-4H3;(H,5,6,7) |
| InChIKey | NSJAENYSNBPEBJ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|