C19H21NO7 — CID 118309698
diethyl 2-(2-hydroxyethyl)-1,3-dioxo-6,8-dihydrocyclopenta[e]isoindole-7,7-dicarboxylate (PubChem CID 118309698) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is diethyl 2-(2-hydroxyethyl)-1,3-dioxo-6,8-dihydrocyclopenta[e]isoindole-7,7-dicarboxylate.
| Compound Name | diethyl 2-(2-hydroxyethyl)-1,3-dioxo-6,8-dihydrocyclopenta[e]isoindole-7,7-dicarboxylate |
|---|---|
| PubChem CID | 118309698 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | diethyl 2-(2-hydroxyethyl)-1,3-dioxo-6,8-dihydrocyclopenta[e]isoindole-7,7-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)Cc2ccc3c(c2C1)C(=O)N(CCO)C3=O |
| InChI | InChI=1S/C19H21NO7/c1-3-26-17(24)19(18(25)27-4-2)9-11-5-6-12-14(13(11)10-19)16(23)20(7-8-21)15(12)22/h5-6,21H,3-4,7-10H2,1-2H3 |
| InChIKey | DGJWSKLCGVNMCL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|