C27H26N4O3 — CID 118309882
2-[[(2S,3R)-3-methyl-2-(5-methyl-2-pyrimidin-2-ylbenzoyl)piperidin-2-yl]methyl]isoindole-1,3-dione (PubChem CID 118309882) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-methyl-2-(5-methyl-2-pyrimidin-2-ylbenzoyl)piperidin-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(2S,3R)-3-methyl-2-(5-methyl-2-pyrimidin-2-ylbenzoyl)piperidin-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118309882 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[[(2S,3R)-3-methyl-2-(5-methyl-2-pyrimidin-2-ylbenzoyl)piperidin-2-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2ncccn2)c(C(=O)[C@]2(CN3C(=O)c4ccccc4C3=O)NCCC[C@H]2C)c1 |
| InChI | InChI=1S/C27H26N4O3/c1-17-10-11-19(24-28-12-6-13-29-24)22(15-17)23(32)27(18(2)7-5-14-30-27)16-31-25(33)20-8-3-4-9-21(20)26(31)34/h3-4,6,8-13,15,18,30H,5,7,14,16H2,1-2H3/t18-,27-/m1/s1 |
| InChIKey | BCHMTIMIMQKPFT-DNOBIOAJSA-N |
| XLogP | 3.69 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|