About 2-nitro-9H-fluorene
2-nitro-9H-fluorene (PubChem CID 11831) has the molecular formula C13H9NO2
and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-nitro-9H-fluorene.
Molecular Properties
| Compound Name | 2-nitro-9H-fluorene |
| PubChem CID | 11831 |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-nitro-9H-fluorene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | XFOHWECQTFIEIX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-9H-fluorene?
The IUPAC name of 2-nitro-9H-fluorene (CID 11831) is 2-nitro-9H-fluorene.
What is the SMILES notation for 2-nitro-9H-fluorene?
The canonical SMILES for 2-nitro-9H-fluorene is O=[N+]([O-])c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 2-nitro-9H-fluorene?
The InChIKey is XFOHWECQTFIEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2.
What are the key properties of 2-nitro-9H-fluorene?
2-nitro-9H-fluorene has a molecular weight of 211.22 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-9H-fluorene is sourced from PubChem (CID 11831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).