About methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate
methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate (PubChem CID 11831021) has the molecular formula C6H7FN2O2S2
and a molecular weight of 222.27 g/mol. Its IUPAC name is methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate.
Molecular Properties
| Compound Name | methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
| PubChem CID | 11831021 |
| Molecular Formula | C6H7FN2O2S2 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate |
| SMILES | COC(=O)C(F)Sc1nnc(C)s1 |
| InChI | InChI=1S/C6H7FN2O2S2/c1-3-8-9-6(12-3)13-4(7)5(10)11-2/h4H,1-2H3 |
| InChIKey | FTNDRKIUSLVIBZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate?
The IUPAC name of methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate (CID 11831021) is methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate.
What is the SMILES notation for methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate?
The canonical SMILES for methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate is COC(=O)C(F)Sc1nnc(C)s1.
What is the InChIKey of methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate?
The InChIKey is FTNDRKIUSLVIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2O2S2/c1-3-8-9-6(12-3)13-4(7)5(10)11-2/h4H,1-2H3.
What are the key properties of methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate?
methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate has a molecular weight of 222.27 g/mol, XLogP of 1.41, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]acetate is sourced from PubChem (CID 11831021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).