About 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine
3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine (PubChem CID 118310232) has the molecular formula C19H17ClF2N4O
and a molecular weight of 390.82 g/mol. Its IUPAC name is 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine |
| PubChem CID | 118310232 |
| Molecular Formula | C19H17ClF2N4O |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine |
| SMILES | Cc1cc2nc(N3CCC(Oc4ccc(F)cc4F)CC3)c(Cl)nc2cn1 |
| InChI | InChI=1S/C19H17ClF2N4O/c1-11-8-15-16(10-23-11)24-18(20)19(25-15)26-6-4-13(5-7-26)27-17-3-2-12(21)9-14(17)22/h2-3,8-10,13H,4-7H2,1H3 |
| InChIKey | AMSBSWSLMBOHFX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine?
The IUPAC name of 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine (CID 118310232) is 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine.
What is the SMILES notation for 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine?
The canonical SMILES for 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine is Cc1cc2nc(N3CCC(Oc4ccc(F)cc4F)CC3)c(Cl)nc2cn1.
What is the InChIKey of 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine?
The InChIKey is AMSBSWSLMBOHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClF2N4O/c1-11-8-15-16(10-23-11)24-18(20)19(25-15)26-6-4-13(5-7-26)27-17-3-2-12(21)9-14(17)22/h2-3,8-10,13H,4-7H2,1H3.
What are the key properties of 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine?
3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine has a molecular weight of 390.82 g/mol, XLogP of 4.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-[4-(2,4-difluorophenoxy)piperidin-1-yl]-7-methylpyrido[3,4-b]pyrazine is sourced from PubChem (CID 118310232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).