C17H23FN2O4 — CID 118310301
methyl 2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzoate (PubChem CID 118310301) has the molecular formula C17H23FN2O4 and a molecular weight of 338.38 g/mol. Its IUPAC name is methyl 2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzoate.
| Compound Name | methyl 2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzoate |
|---|---|
| PubChem CID | 118310301 |
| Molecular Formula | C17H23FN2O4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | methyl 2-fluoro-5-nitro-4-[(3,3,5-trimethylcyclohexyl)amino]benzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])c(NC2CC(C)CC(C)(C)C2)cc1F |
| InChI | InChI=1S/C17H23FN2O4/c1-10-5-11(9-17(2,3)8-10)19-14-7-13(18)12(16(21)24-4)6-15(14)20(22)23/h6-7,10-11,19H,5,8-9H2,1-4H3 |
| InChIKey | RMCRVGKWHLIXKO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|