C22H36N2O3 — CID 118310583
2-[3-amino-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenoxy]-3,3-dimethylbutanoic acid (PubChem CID 118310583) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-[3-amino-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenoxy]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[3-amino-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenoxy]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 118310583 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | 2-[3-amino-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenoxy]-3,3-dimethylbutanoic acid |
| SMILES | CC1(C)CC(Nc2ccc(OC(C(=O)O)C(C)(C)C)cc2N)CC(C)(C)C1 |
| InChI | InChI=1S/C22H36N2O3/c1-20(2,3)18(19(25)26)27-15-8-9-17(16(23)10-15)24-14-11-21(4,5)13-22(6,7)12-14/h8-10,14,18,24H,11-13,23H2,1-7H3,(H,25,26) |
| InChIKey | FMVCASSKGRBVNY-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|