C20H31FN2O2 — CID 118310585
methyl 3-[3-amino-2-fluoro-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]propanoate (PubChem CID 118310585) has the molecular formula C20H31FN2O2 and a molecular weight of 350.48 g/mol. Its IUPAC name is methyl 3-[3-amino-2-fluoro-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]propanoate.
| Compound Name | methyl 3-[3-amino-2-fluoro-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]propanoate |
|---|---|
| PubChem CID | 118310585 |
| Molecular Formula | C20H31FN2O2 |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | methyl 3-[3-amino-2-fluoro-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(NC2CC(C)(C)CC(C)(C)C2)c(N)c1F |
| InChI | InChI=1S/C20H31FN2O2/c1-19(2)10-14(11-20(3,4)12-19)23-15-8-6-13(17(21)18(15)22)7-9-16(24)25-5/h6,8,14,23H,7,9-12,22H2,1-5H3 |
| InChIKey | AZJWHUQTUHOLQQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|