About 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine
1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine (PubChem CID 118311039) has the molecular formula C23H29N3O
and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine.
Molecular Properties
| Compound Name | 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine |
| PubChem CID | 118311039 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine |
| SMILES | CC(C)Oc1ccc(Nc2nc3ccccc3n2[C@@H]2CCC[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C23H29N3O/c1-16(2)27-20-13-11-18(12-14-20)24-23-25-21-9-4-5-10-22(21)26(23)19-8-6-7-17(3)15-19/h4-5,9-14,16-17,19H,6-8,15H2,1-3H3,(H,24,25)/t17-,19-/m1/s1 |
| InChIKey | UUECNAKSHFUENG-IEBWSBKVSA-N |
| XLogP | 6.32 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine?
The IUPAC name of 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine (CID 118311039) is 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine.
What is the SMILES notation for 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine?
The canonical SMILES for 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine is CC(C)Oc1ccc(Nc2nc3ccccc3n2[C@@H]2CCC[C@@H](C)C2)cc1.
What is the InChIKey of 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine?
The InChIKey is UUECNAKSHFUENG-IEBWSBKVSA-N. The full InChI is InChI=1S/C23H29N3O/c1-16(2)27-20-13-11-18(12-14-20)24-23-25-21-9-4-5-10-22(21)26(23)19-8-6-7-17(3)15-19/h4-5,9-14,16-17,19H,6-8,15H2,1-3H3,(H,24,25)/t17-,19-/m1/s1.
What are the key properties of 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine?
1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine has a molecular weight of 363.51 g/mol, XLogP of 6.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,3R)-3-methylcyclohexyl]-N-(4-propan-2-yloxyphenyl)benzimidazol-2-amine is sourced from PubChem (CID 118311039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).