C18H30N2O2 — CID 118311113
4-(ethoxymethoxy)-2-N-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine (PubChem CID 118311113) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 4-(ethoxymethoxy)-2-N-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine.
| Compound Name | 4-(ethoxymethoxy)-2-N-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 118311113 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 4-(ethoxymethoxy)-2-N-[(1R,5R)-3,3,5-trimethylcyclohexyl]benzene-1,2-diamine |
| SMILES | CCOCOc1ccc(N)c(N[C@@H]2C[C@H](C)CC(C)(C)C2)c1 |
| InChI | InChI=1S/C18H30N2O2/c1-5-21-12-22-15-6-7-16(19)17(9-15)20-14-8-13(2)10-18(3,4)11-14/h6-7,9,13-14,20H,5,8,10-12,19H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | YSNCIDXENRDZQB-UONOGXRCSA-N |
| XLogP | 4.27 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|