C17H25NO — CID 118311785
(2S)-1-ethyl-5,6-dimethylidene-4-[(3Z)-penta-1,3-dien-2-yl]-3-propyl-2H-pyridin-2-ol (PubChem CID 118311785) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (2S)-1-ethyl-5,6-dimethylidene-4-[(3Z)-penta-1,3-dien-2-yl]-3-propyl-2H-pyridin-2-ol.
| Compound Name | (2S)-1-ethyl-5,6-dimethylidene-4-[(3Z)-penta-1,3-dien-2-yl]-3-propyl-2H-pyridin-2-ol |
|---|---|
| PubChem CID | 118311785 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2S)-1-ethyl-5,6-dimethylidene-4-[(3Z)-penta-1,3-dien-2-yl]-3-propyl-2H-pyridin-2-ol |
| SMILES | C=C(/C=C\C)C1=C(CCC)[C@H](O)N(CC)C(=C)C1=C |
| InChI | InChI=1S/C17H25NO/c1-7-10-12(4)16-13(5)14(6)18(9-3)17(19)15(16)11-8-2/h7,10,17,19H,4-6,8-9,11H2,1-3H3/b10-7-/t17-/m0/s1 |
| InChIKey | GHAIMVZSEZDUPS-JEZWAEDTSA-N |
| XLogP | 3.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|