About 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine
2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine (PubChem CID 118311793) has the molecular formula C13H18FN3O
and a molecular weight of 251.30 g/mol. Its IUPAC name is 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine |
| PubChem CID | 118311793 |
| Molecular Formula | C13H18FN3O |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine |
| SMILES | C/C=C(\C=C/C(C)C)COc1ncc(F)c(N)n1 |
| InChI | InChI=1S/C13H18FN3O/c1-4-10(6-5-9(2)3)8-18-13-16-7-11(14)12(15)17-13/h4-7,9H,8H2,1-3H3,(H2,15,16,17)/b6-5-,10-4+ |
| InChIKey | ORDPZFHGJKGILC-QYONPMAVSA-N |
| XLogP | 2.74 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine?
The IUPAC name of 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine (CID 118311793) is 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine.
What is the SMILES notation for 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine?
The canonical SMILES for 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine is C/C=C(\C=C/C(C)C)COc1ncc(F)c(N)n1.
What is the InChIKey of 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine?
The InChIKey is ORDPZFHGJKGILC-QYONPMAVSA-N. The full InChI is InChI=1S/C13H18FN3O/c1-4-10(6-5-9(2)3)8-18-13-16-7-11(14)12(15)17-13/h4-7,9H,8H2,1-3H3,(H2,15,16,17)/b6-5-,10-4+.
What are the key properties of 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine?
2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine has a molecular weight of 251.30 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z,2E)-2-ethylidene-5-methylhex-3-enoxy]-5-fluoropyrimidin-4-amine is sourced from PubChem (CID 118311793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).