C12H19F2N — CID 118311879
4-[(1S,4S)-4-(1,1-difluoroethyl)cyclohex-2-en-1-yl]but-1-en-2-amine (PubChem CID 118311879) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is 4-[(1S,4S)-4-(1,1-difluoroethyl)cyclohex-2-en-1-yl]but-1-en-2-amine.
| Compound Name | 4-[(1S,4S)-4-(1,1-difluoroethyl)cyclohex-2-en-1-yl]but-1-en-2-amine |
|---|---|
| PubChem CID | 118311879 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 4-[(1S,4S)-4-(1,1-difluoroethyl)cyclohex-2-en-1-yl]but-1-en-2-amine |
| SMILES | C=C(N)CC[C@H]1C=C[C@@H](C(C)(F)F)CC1 |
| InChI | InChI=1S/C12H19F2N/c1-9(15)3-4-10-5-7-11(8-6-10)12(2,13)14/h5,7,10-11H,1,3-4,6,8,15H2,2H3/t10-,11+/m0/s1 |
| InChIKey | FGEUQVAYOYRHRT-WDEREUQCSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|