C16H26N2 — CID 118311917
(9aS)-2-(5-methylcyclohex-2-en-1-yl)-2,3,4,5,7,8,9,9a-octahydro-1H-1,3-benzodiazepine (PubChem CID 118311917) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (9aS)-2-(5-methylcyclohex-2-en-1-yl)-2,3,4,5,7,8,9,9a-octahydro-1H-1,3-benzodiazepine.
| Compound Name | (9aS)-2-(5-methylcyclohex-2-en-1-yl)-2,3,4,5,7,8,9,9a-octahydro-1H-1,3-benzodiazepine |
|---|---|
| PubChem CID | 118311917 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (9aS)-2-(5-methylcyclohex-2-en-1-yl)-2,3,4,5,7,8,9,9a-octahydro-1H-1,3-benzodiazepine |
| SMILES | CC1CC=CC(C2NCCC3=CCCC[C@@H]3N2)C1 |
| InChI | InChI=1S/C16H26N2/c1-12-5-4-7-14(11-12)16-17-10-9-13-6-2-3-8-15(13)18-16/h4,6-7,12,14-18H,2-3,5,8-11H2,1H3/t12?,14?,15-,16?/m0/s1 |
| InChIKey | PYGTVBBKNXFOPX-YLECJSOOSA-N |
| XLogP | 2.98 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|