About 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate
2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate (PubChem CID 118312008) has the molecular formula C15H17FO4
and a molecular weight of 280.30 g/mol. Its IUPAC name is 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate.
Molecular Properties
| Compound Name | 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate |
| PubChem CID | 118312008 |
| Molecular Formula | C15H17FO4 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate |
| SMILES | CC(C)(C)C(=O)OC(=O)[C@@H]1CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C15H17FO4/c1-15(2,3)14(18)20-13(17)12-6-4-9-8-10(16)5-7-11(9)19-12/h5,7-8,12H,4,6H2,1-3H3/t12-/m0/s1 |
| InChIKey | FBGHCHLTYNWQDG-LBPRGKRZSA-N |
| XLogP | 2.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate?
The IUPAC name of 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate (CID 118312008) is 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate.
What is the SMILES notation for 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate?
The canonical SMILES for 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate is CC(C)(C)C(=O)OC(=O)[C@@H]1CCc2cc(F)ccc2O1.
What is the InChIKey of 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate?
The InChIKey is FBGHCHLTYNWQDG-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H17FO4/c1-15(2,3)14(18)20-13(17)12-6-4-9-8-10(16)5-7-11(9)19-12/h5,7-8,12H,4,6H2,1-3H3/t12-/m0/s1.
What are the key properties of 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate?
2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate has a molecular weight of 280.30 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropanoyl (2S)-6-fluoro-3,4-dihydro-2H-chromene-2-carboxylate is sourced from PubChem (CID 118312008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).