C39H47NO6 — CID 118312317
3-[4-[(5R,11R)-5,17-dihydroxy-5',5',13-trimethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-11-yl]phenyl]prop-2-ynyl N-phenylcarbamate (PubChem CID 118312317) has the molecular formula C39H47NO6 and a molecular weight of 625.81 g/mol. Its IUPAC name is 3-[4-[(5R,11R)-5,17-dihydroxy-5',5',13-trimethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-11-yl]phenyl]prop-2-ynyl N-phenylcarbamate.
| Compound Name | 3-[4-[(5R,11R)-5,17-dihydroxy-5',5',13-trimethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-11-yl]phenyl]prop-2-ynyl N-phenylcarbamate |
|---|---|
| PubChem CID | 118312317 |
| Molecular Formula | C39H47NO6 |
| Molecular Weight | 625.81 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 3-[4-[(5R,11R)-5,17-dihydroxy-5',5',13-trimethylspiro[1,2,4,6,7,8,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxane]-11-yl]phenyl]prop-2-ynyl N-phenylcarbamate |
| SMILES | CC1(C)COC2(CCC3=C4C(CC[C@@]3(O)C2)C2CCC(O)C2(C)C[C@@H]4c2ccc(C#CCOC(=O)Nc3ccccc3)cc2)OC1 |
| InChI | InChI=1S/C39H47NO6/c1-36(2)24-45-39(46-25-36)20-18-32-34-29(17-19-38(32,43)23-39)31-15-16-33(41)37(31,3)22-30(34)27-13-11-26(12-14-27)8-7-21-44-35(42)40-28-9-5-4-6-10-28/h4-6,9-14,29-31,33,41,43H,15-25H2,1-3H3,(H,40,42)/t29?,30-,31?,33?,37?,38-/m1/s1 |
| InChIKey | CBZSIVWRFBFUBO-GKKGADOVSA-N |
| XLogP | 6.94 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.81 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|