About 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine
2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine (PubChem CID 118312330) has the molecular formula C14H13FN4O
and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine |
| PubChem CID | 118312330 |
| Molecular Formula | C14H13FN4O |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine |
| SMILES | Nc1nc(OCC2=CC=NC3=CC=CC[C@H]23)ncc1F |
| InChI | InChI=1S/C14H13FN4O/c15-11-7-18-14(19-13(11)16)20-8-9-5-6-17-12-4-2-1-3-10(9)12/h1-2,4-7,10H,3,8H2,(H2,16,18,19)/t10-/m1/s1 |
| InChIKey | ZXGPMZVSHJKYCA-SNVBAGLBSA-N |
| XLogP | 2.05 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine?
The IUPAC name of 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine (CID 118312330) is 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine.
What is the SMILES notation for 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine?
The canonical SMILES for 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine is Nc1nc(OCC2=CC=NC3=CC=CC[C@H]23)ncc1F.
What is the InChIKey of 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine?
The InChIKey is ZXGPMZVSHJKYCA-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H13FN4O/c15-11-7-18-14(19-13(11)16)20-8-9-5-6-17-12-4-2-1-3-10(9)12/h1-2,4-7,10H,3,8H2,(H2,16,18,19)/t10-/m1/s1.
What are the key properties of 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine?
2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine has a molecular weight of 272.28 g/mol, XLogP of 2.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(4aR)-4a,5-dihydroquinolin-4-yl]methoxy]-5-fluoropyrimidin-4-amine is sourced from PubChem (CID 118312330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).