C34H35FN2O3 — CID 118312348
1-(4-fluorophenyl)-3-[3-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]phenyl]prop-2-ynyl]urea (PubChem CID 118312348) has the molecular formula C34H35FN2O3 and a molecular weight of 538.66 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[3-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]phenyl]prop-2-ynyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[3-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 118312348 |
| Molecular Formula | C34H35FN2O3 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[3-[4-[(11R)-17-hydroxy-13-methyl-3-oxo-2,6,7,8,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-11-yl]phenyl]prop-2-ynyl]urea |
| SMILES | CC12C[C@H](c3ccc(C#CCNC(=O)Nc4ccc(F)cc4)cc3)C3=C4CCC(=O)C=C4CCC3C1CCC2O |
| InChI | InChI=1S/C34H35FN2O3/c1-34-20-29(32-27-15-13-26(38)19-23(27)8-14-28(32)30(34)16-17-31(34)39)22-6-4-21(5-7-22)3-2-18-36-33(40)37-25-11-9-24(35)10-12-25/h4-7,9-12,19,28-31,39H,8,13-18,20H2,1H3,(H2,36,37,40)/t28?,29-,30?,31?,34?/m1/s1 |
| InChIKey | CHPBZOXIUKQKIT-XTUBQURBSA-N |
| XLogP | 6.26 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|