About 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine
2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine (PubChem CID 118312426) has the molecular formula C10H13F2NO
and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine.
Molecular Properties
| Compound Name | 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine |
| PubChem CID | 118312426 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine |
| SMILES | FC1=CC=C(C2CNCCO2)[C@@H](F)C1 |
| InChI | InChI=1S/C10H13F2NO/c11-7-1-2-8(9(12)5-7)10-6-13-3-4-14-10/h1-2,9-10,13H,3-6H2/t9-,10?/m0/s1 |
| InChIKey | ZCYFXQKORAMPRD-RGURZIINSA-N |
| XLogP | 1.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine?
The IUPAC name of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine (CID 118312426) is 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine.
What is the SMILES notation for 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine?
The canonical SMILES for 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine is FC1=CC=C(C2CNCCO2)[C@@H](F)C1.
What is the InChIKey of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine?
The InChIKey is ZCYFXQKORAMPRD-RGURZIINSA-N. The full InChI is InChI=1S/C10H13F2NO/c11-7-1-2-8(9(12)5-7)10-6-13-3-4-14-10/h1-2,9-10,13H,3-6H2/t9-,10?/m0/s1.
What are the key properties of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine?
2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine has a molecular weight of 201.22 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]morpholine is sourced from PubChem (CID 118312426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).