C25H18N4 — CID 118312445
N-fluoranthen-3-yl-N-phenyl-1,4-dihydro-1,3,5-triazin-2-amine (PubChem CID 118312445) has the molecular formula C25H18N4 and a molecular weight of 374.45 g/mol. Its IUPAC name is N-fluoranthen-3-yl-N-phenyl-1,4-dihydro-1,3,5-triazin-2-amine.
| Compound Name | N-fluoranthen-3-yl-N-phenyl-1,4-dihydro-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118312445 |
| Molecular Formula | C25H18N4 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-fluoranthen-3-yl-N-phenyl-1,4-dihydro-1,3,5-triazin-2-amine |
| SMILES | C1=NCN=C(N(c2ccccc2)c2ccc3c4c(cccc24)-c2ccccc2-3)N1 |
| InChI | InChI=1S/C25H18N4/c1-2-7-17(8-3-1)29(25-27-15-26-16-28-25)23-14-13-21-19-10-5-4-9-18(19)20-11-6-12-22(23)24(20)21/h1-15H,16H2,(H,26,27,28) |
| InChIKey | JRRJQBYJNMTYEX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |