About 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine
2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine (PubChem CID 118312470) has the molecular formula C10H14F2N2
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine.
Molecular Properties
| Compound Name | 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine |
| PubChem CID | 118312470 |
| Molecular Formula | C10H14F2N2 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine |
| SMILES | FC1=CC=C(C2CNCCN2)[C@@H](F)C1 |
| InChI | InChI=1S/C10H14F2N2/c11-7-1-2-8(9(12)5-7)10-6-13-3-4-14-10/h1-2,9-10,13-14H,3-6H2/t9-,10?/m0/s1 |
| InChIKey | RCHDPOZIELIDJS-RGURZIINSA-N |
| XLogP | 1.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine?
The IUPAC name of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine (CID 118312470) is 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine.
What is the SMILES notation for 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine?
The canonical SMILES for 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine is FC1=CC=C(C2CNCCN2)[C@@H](F)C1.
What is the InChIKey of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine?
The InChIKey is RCHDPOZIELIDJS-RGURZIINSA-N. The full InChI is InChI=1S/C10H14F2N2/c11-7-1-2-8(9(12)5-7)10-6-13-3-4-14-10/h1-2,9-10,13-14H,3-6H2/t9-,10?/m0/s1.
What are the key properties of 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine?
2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine has a molecular weight of 200.23 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6S)-4,6-difluorocyclohexa-1,3-dien-1-yl]piperazine is sourced from PubChem (CID 118312470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).