C17H23NO2 — CID 118312471
6-[(1R)-3-cyclohepta-2,4,6-trien-1-yl-1-hydroxy-2-methylidenebutyl]-1,2,3,4-tetrahydropyridin-5-ol (PubChem CID 118312471) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 6-[(1R)-3-cyclohepta-2,4,6-trien-1-yl-1-hydroxy-2-methylidenebutyl]-1,2,3,4-tetrahydropyridin-5-ol.
| Compound Name | 6-[(1R)-3-cyclohepta-2,4,6-trien-1-yl-1-hydroxy-2-methylidenebutyl]-1,2,3,4-tetrahydropyridin-5-ol |
|---|---|
| PubChem CID | 118312471 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 6-[(1R)-3-cyclohepta-2,4,6-trien-1-yl-1-hydroxy-2-methylidenebutyl]-1,2,3,4-tetrahydropyridin-5-ol |
| SMILES | C=C(C(C)C1C=CC=CC=C1)[C@@H](O)C1=C(O)CCCN1 |
| InChI | InChI=1S/C17H23NO2/c1-12(14-8-5-3-4-6-9-14)13(2)17(20)16-15(19)10-7-11-18-16/h3-6,8-9,12,14,17-20H,2,7,10-11H2,1H3/t12?,17-/m1/s1 |
| InChIKey | MZFUTPPMZWJWDJ-RGUGMKFQSA-N |
| XLogP | 2.99 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|