C50H42N2 — CID 118312814
2-[(2E,4Z,8Z,10Z)-6,7-dimethylidene-1-(3-phenylphenyl)-1-azacyclododeca-2,4,8,10-tetraen-3-yl]-2-methyl-9-(3-phenylphenyl)-1H-carbazole (PubChem CID 118312814) has the molecular formula C50H42N2 and a molecular weight of 670.90 g/mol. Its IUPAC name is 2-[(2E,4Z,8Z,10Z)-6,7-dimethylidene-1-(3-phenylphenyl)-1-azacyclododeca-2,4,8,10-tetraen-3-yl]-2-methyl-9-(3-phenylphenyl)-1H-carbazole.
| Compound Name | 2-[(2E,4Z,8Z,10Z)-6,7-dimethylidene-1-(3-phenylphenyl)-1-azacyclododeca-2,4,8,10-tetraen-3-yl]-2-methyl-9-(3-phenylphenyl)-1H-carbazole |
|---|---|
| PubChem CID | 118312814 |
| Molecular Formula | C50H42N2 |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.33 |
| IUPAC Name | 2-[(2E,4Z,8Z,10Z)-6,7-dimethylidene-1-(3-phenylphenyl)-1-azacyclododeca-2,4,8,10-tetraen-3-yl]-2-methyl-9-(3-phenylphenyl)-1H-carbazole |
| SMILES | C=C1/C=C\C=C/CN(c2cccc(-c3ccccc3)c2)/C=C(C2(C)C=Cc3c(n(-c4cccc(-c5ccccc5)c4)c4ccccc34)C2)\C=C/C1=C |
| InChI | InChI=1S/C50H42N2/c1-37-17-7-6-14-32-51(44-24-15-22-41(33-44)39-18-8-4-9-19-39)36-43(29-28-38(37)2)50(3)31-30-47-46-26-12-13-27-48(46)52(49(47)35-50)45-25-16-23-42(34-45)40-20-10-5-11-21-40/h4-31,33-34,36H,1-2,32,35H2,3H3/b14-6-,17-7-,29-28-,43-36+ |
| InChIKey | IKRSYFNYBKLKMC-ZDJNGDQGSA-N |
| XLogP | 12.73 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |