C24H30FN3 — CID 118312908
1-[3-(3-fluoro-5-methylphenyl)-5-(4-methylcyclohexen-1-yl)-4-pyridinyl]piperidin-4-amine (PubChem CID 118312908) has the molecular formula C24H30FN3 and a molecular weight of 379.52 g/mol. Its IUPAC name is 1-[3-(3-fluoro-5-methylphenyl)-5-(4-methylcyclohexen-1-yl)-4-pyridinyl]piperidin-4-amine.
| Compound Name | 1-[3-(3-fluoro-5-methylphenyl)-5-(4-methylcyclohexen-1-yl)-4-pyridinyl]piperidin-4-amine |
|---|---|
| PubChem CID | 118312908 |
| Molecular Formula | C24H30FN3 |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-[3-(3-fluoro-5-methylphenyl)-5-(4-methylcyclohexen-1-yl)-4-pyridinyl]piperidin-4-amine |
| SMILES | Cc1cc(F)cc(-c2cncc(C3=CCC(C)CC3)c2N2CCC(N)CC2)c1 |
| InChI | InChI=1S/C24H30FN3/c1-16-3-5-18(6-4-16)22-14-27-15-23(19-11-17(2)12-20(25)13-19)24(22)28-9-7-21(26)8-10-28/h5,11-16,21H,3-4,6-10,26H2,1-2H3 |
| InChIKey | ROAVLRHTGIDFSU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |