About [(1R)-2-oxocycloheptyl] benzoate
[(1R)-2-oxocycloheptyl] benzoate (PubChem CID 11831295) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is [(1R)-2-oxocycloheptyl] benzoate.
Molecular Properties
| Compound Name | [(1R)-2-oxocycloheptyl] benzoate |
| PubChem CID | 11831295 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | [(1R)-2-oxocycloheptyl] benzoate |
| SMILES | O=C(O[C@@H]1CCCCCC1=O)c1ccccc1 |
| InChI | InChI=1S/C14H16O3/c15-12-9-5-2-6-10-13(12)17-14(16)11-7-3-1-4-8-11/h1,3-4,7-8,13H,2,5-6,9-10H2/t13-/m1/s1 |
| InChIKey | APFABFFIGWWJSK-CYBMUJFWSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R)-2-oxocycloheptyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-oxocycloheptyl] benzoate?
The IUPAC name of [(1R)-2-oxocycloheptyl] benzoate (CID 11831295) is [(1R)-2-oxocycloheptyl] benzoate.
What is the SMILES notation for [(1R)-2-oxocycloheptyl] benzoate?
The canonical SMILES for [(1R)-2-oxocycloheptyl] benzoate is O=C(O[C@@H]1CCCCCC1=O)c1ccccc1.
What is the InChIKey of [(1R)-2-oxocycloheptyl] benzoate?
The InChIKey is APFABFFIGWWJSK-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H16O3/c15-12-9-5-2-6-10-13(12)17-14(16)11-7-3-1-4-8-11/h1,3-4,7-8,13H,2,5-6,9-10H2/t13-/m1/s1.
What are the key properties of [(1R)-2-oxocycloheptyl] benzoate?
[(1R)-2-oxocycloheptyl] benzoate has a molecular weight of 232.28 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-oxocycloheptyl] benzoate is sourced from PubChem (CID 11831295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).