C6H10F2 — CID 118313015
1,1-difluoro-2,3-dimethylbut-2-ene (PubChem CID 118313015) has the molecular formula C6H10F2 and a molecular weight of 120.14 g/mol. Its IUPAC name is 1,1-difluoro-2,3-dimethylbut-2-ene.
| Compound Name | 1,1-difluoro-2,3-dimethylbut-2-ene |
|---|---|
| PubChem CID | 118313015 |
| Molecular Formula | C6H10F2 |
| Molecular Weight | 120.14 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | 1,1-difluoro-2,3-dimethylbut-2-ene |
| SMILES | CC(C)=C(C)C(F)F |
| InChI | InChI=1S/C6H10F2/c1-4(2)5(3)6(7)8/h6H,1-3H3 |
| InChIKey | ASALGERIYAJZRJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|