About (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol
(2E)-2-(dimethylhydrazinylidene)propane-1,1-diol (PubChem CID 118313527) has the molecular formula C5H12N2O2
and a molecular weight of 132.16 g/mol. Its IUPAC name is (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol.
Molecular Properties
| Compound Name | (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol |
| PubChem CID | 118313527 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol |
| SMILES | C/C(=N\N(C)C)C(O)O |
| InChI | InChI=1S/C5H12N2O2/c1-4(5(8)9)6-7(2)3/h5,8-9H,1-3H3/b6-4+ |
| InChIKey | GVAPUHNUFNYCBB-GQCTYLIASA-N |
| XLogP | -0.77 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol?
The IUPAC name of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol (CID 118313527) is (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol.
What is the SMILES notation for (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol?
The canonical SMILES for (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol is C/C(=N\N(C)C)C(O)O.
What is the InChIKey of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol?
The InChIKey is GVAPUHNUFNYCBB-GQCTYLIASA-N. The full InChI is InChI=1S/C5H12N2O2/c1-4(5(8)9)6-7(2)3/h5,8-9H,1-3H3/b6-4+.
What are the key properties of (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol?
(2E)-2-(dimethylhydrazinylidene)propane-1,1-diol has a molecular weight of 132.16 g/mol, XLogP of -0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(dimethylhydrazinylidene)propane-1,1-diol is sourced from PubChem (CID 118313527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).