C15H25NO — CID 11831401
(9R,9aR)-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one (PubChem CID 11831401) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (9R,9aR)-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one.
| Compound Name | (9R,9aR)-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one |
|---|---|
| PubChem CID | 11831401 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (9R,9aR)-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one |
| SMILES | C=CC[C@@]12CCCN1C(=O)CCC[C@@H]2C(C)C |
| InChI | InChI=1S/C15H25NO/c1-4-9-15-10-6-11-16(15)14(17)8-5-7-13(15)12(2)3/h4,12-13H,1,5-11H2,2-3H3/t13-,15+/m1/s1 |
| InChIKey | IGEXQISKQHOFAI-HIFRSBDPSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|