C21H28N2O2S — CID 118314265
4-methyl-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)piperidine (PubChem CID 118314265) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 4-methyl-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)piperidine.
| Compound Name | 4-methyl-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)piperidine |
|---|---|
| PubChem CID | 118314265 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 4-methyl-1-(1-naphthalen-1-ylsulfonylpiperidin-4-yl)piperidine |
| SMILES | CC1CCN(C2CCN(S(=O)(=O)c3cccc4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C21H28N2O2S/c1-17-9-13-22(14-10-17)19-11-15-23(16-12-19)26(24,25)21-8-4-6-18-5-2-3-7-20(18)21/h2-8,17,19H,9-16H2,1H3 |
| InChIKey | XJNICBLWQSTVHY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |