About 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone
1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone (PubChem CID 118314357) has the molecular formula C16H20O
and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone |
| PubChem CID | 118314357 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone |
| SMILES | CC(=O)c1ccc(C)c2c1CCC21CCCC1 |
| InChI | InChI=1S/C16H20O/c1-11-5-6-13(12(2)17)14-7-10-16(15(11)14)8-3-4-9-16/h5-6H,3-4,7-10H2,1-2H3 |
| InChIKey | LOGIHEZIVLIKDI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone?
The IUPAC name of 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone (CID 118314357) is 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone.
What is the SMILES notation for 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone?
The canonical SMILES for 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone is CC(=O)c1ccc(C)c2c1CCC21CCCC1.
What is the InChIKey of 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone?
The InChIKey is LOGIHEZIVLIKDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O/c1-11-5-6-13(12(2)17)14-7-10-16(15(11)14)8-3-4-9-16/h5-6H,3-4,7-10H2,1-2H3.
What are the key properties of 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone?
1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone has a molecular weight of 228.34 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-methylspiro[2,3-dihydroindene-1,1'-cyclopentane]-4-yl)ethanone is sourced from PubChem (CID 118314357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).