About 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane]
5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] (PubChem CID 118314439) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane].
Molecular Properties
| Compound Name | 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] |
| PubChem CID | 118314439 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] |
| SMILES | COc1ccc(OC)c2c1CC=CC21CCC1 |
| InChI | InChI=1S/C15H18O2/c1-16-12-6-7-13(17-2)14-11(12)5-3-8-15(14)9-4-10-15/h3,6-8H,4-5,9-10H2,1-2H3 |
| InChIKey | QFNXMLWFNXFEJY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane]?
The IUPAC name of 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] (CID 118314439) is 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane].
What is the SMILES notation for 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane]?
The canonical SMILES for 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] is COc1ccc(OC)c2c1CC=CC21CCC1.
What is the InChIKey of 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane]?
The InChIKey is QFNXMLWFNXFEJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c1-16-12-6-7-13(17-2)14-11(12)5-3-8-15(14)9-4-10-15/h3,6-8H,4-5,9-10H2,1-2H3.
What are the key properties of 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane]?
5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] has a molecular weight of 230.31 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethoxyspiro[1H-naphthalene-4,1'-cyclobutane] is sourced from PubChem (CID 118314439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).