C15H23N3O3S — CID 118314577
3-[(2R,5S)-4-hydroxy-5-(propylsulfanylmethyl)oxolan-2-yl]-7,8-dihydro-6H-imidazo[4,5-b]azepin-8-ol (PubChem CID 118314577) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 3-[(2R,5S)-4-hydroxy-5-(propylsulfanylmethyl)oxolan-2-yl]-7,8-dihydro-6H-imidazo[4,5-b]azepin-8-ol.
| Compound Name | 3-[(2R,5S)-4-hydroxy-5-(propylsulfanylmethyl)oxolan-2-yl]-7,8-dihydro-6H-imidazo[4,5-b]azepin-8-ol |
|---|---|
| PubChem CID | 118314577 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-[(2R,5S)-4-hydroxy-5-(propylsulfanylmethyl)oxolan-2-yl]-7,8-dihydro-6H-imidazo[4,5-b]azepin-8-ol |
| SMILES | CCCSC[C@H]1O[C@@H](n2cnc3c2N=CCCC3O)CC1O |
| InChI | InChI=1S/C15H23N3O3S/c1-2-6-22-8-12-11(20)7-13(21-12)18-9-17-14-10(19)4-3-5-16-15(14)18/h5,9-13,19-20H,2-4,6-8H2,1H3/t10?,11?,12-,13-/m1/s1 |
| InChIKey | WLOBLAKDVWLFCO-FIYWTHMPSA-N |
| XLogP | 2.20 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|