About 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol
2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol (PubChem CID 118314647) has the molecular formula C13H12F2N2O2S
and a molecular weight of 298.31 g/mol. Its IUPAC name is 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol.
Molecular Properties
| Compound Name | 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol |
| PubChem CID | 118314647 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol |
| SMILES | Oc1c(-c2csc(N3CCOCC3)n2)ccc(F)c1F |
| InChI | InChI=1S/C13H12F2N2O2S/c14-9-2-1-8(12(18)11(9)15)10-7-20-13(16-10)17-3-5-19-6-4-17/h1-2,7,18H,3-6H2 |
| InChIKey | MSJISRJFQIZJOG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol?
The IUPAC name of 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol (CID 118314647) is 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol.
What is the SMILES notation for 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol?
The canonical SMILES for 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol is Oc1c(-c2csc(N3CCOCC3)n2)ccc(F)c1F.
What is the InChIKey of 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol?
The InChIKey is MSJISRJFQIZJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2O2S/c14-9-2-1-8(12(18)11(9)15)10-7-20-13(16-10)17-3-5-19-6-4-17/h1-2,7,18H,3-6H2.
What are the key properties of 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol?
2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol has a molecular weight of 298.31 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-6-(2-morpholin-4-yl-1,3-thiazol-4-yl)phenol is sourced from PubChem (CID 118314647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).