pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate

C13H18O4 — CID 11831475

IUPACpent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate
SMILESC=CCCCOC(=O)C1=CC(=O)CC(C)(C)O1
InChIInChI=1S/C13H18O4/c1-4-5-6-7-16-12(15)11-8-10(14)9-13(2,3)17-11/h4,8H,1,5-7,9H2,2-3H3
InChIKeySERMYFYNUABVIL-UHFFFAOYSA-N
MW238.28 g/mol
LogP2.15
Rot. Bonds5

About pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate

pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate (PubChem CID 11831475) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate.

Molecular Properties

Compound Namepent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate
PubChem CID11831475
Molecular FormulaC13H18O4
Molecular Weight238.28 g/mol
Exact Mass238.12
IUPAC Namepent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate
SMILESC=CCCCOC(=O)C1=CC(=O)CC(C)(C)O1
InChIInChI=1S/C13H18O4/c1-4-5-6-7-16-12(15)11-8-10(14)9-13(2,3)17-11/h4,8H,1,5-7,9H2,2-3H3
InChIKeySERMYFYNUABVIL-UHFFFAOYSA-N
XLogP2.15
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.28
LogP ≤ 52.15
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate?
The IUPAC name of pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate (CID 11831475) is pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate.
What is the SMILES notation for pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate?
The canonical SMILES for pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate is C=CCCCOC(=O)C1=CC(=O)CC(C)(C)O1.
What is the InChIKey of pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate?
The InChIKey is SERMYFYNUABVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O4/c1-4-5-6-7-16-12(15)11-8-10(14)9-13(2,3)17-11/h4,8H,1,5-7,9H2,2-3H3.
What are the key properties of pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate?
pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate has a molecular weight of 238.28 g/mol, XLogP of 2.15, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate is sourced from PubChem (CID 11831475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).