C13H18O4 — CID 11831475
pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate (PubChem CID 11831475) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate.
| Compound Name | pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 11831475 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | pent-4-enyl 2,2-dimethyl-4-oxo-3H-pyran-6-carboxylate |
| SMILES | C=CCCCOC(=O)C1=CC(=O)CC(C)(C)O1 |
| InChI | InChI=1S/C13H18O4/c1-4-5-6-7-16-12(15)11-8-10(14)9-13(2,3)17-11/h4,8H,1,5-7,9H2,2-3H3 |
| InChIKey | SERMYFYNUABVIL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|