C52H38N4 — CID 118315166
N,9-bis(4-methylphenyl)-N-[3-(1-phenylpyrrolo[2,3-a]carbazol-10-yl)phenyl]carbazol-3-amine (PubChem CID 118315166) has the molecular formula C52H38N4 and a molecular weight of 718.90 g/mol. Its IUPAC name is N,9-bis(4-methylphenyl)-N-[3-(1-phenylpyrrolo[2,3-a]carbazol-10-yl)phenyl]carbazol-3-amine.
| Compound Name | N,9-bis(4-methylphenyl)-N-[3-(1-phenylpyrrolo[2,3-a]carbazol-10-yl)phenyl]carbazol-3-amine |
|---|---|
| PubChem CID | 118315166 |
| Molecular Formula | C52H38N4 |
| Molecular Weight | 718.90 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | N,9-bis(4-methylphenyl)-N-[3-(1-phenylpyrrolo[2,3-a]carbazol-10-yl)phenyl]carbazol-3-amine |
| SMILES | CC1=CC=C(C=C1)N2C3=C(C=C(C=C3)N(C4=CC=C(C=C4)C)C5=CC=CC(=C5)N6C7=CC=CC=C7C8=C6C9=C(C=C8)C=CN9C1=CC=CC=C1)C1=CC=CC=C12 |
| InChI | InChI=1S/C52H38N4/c1-35-19-24-39(25-20-35)54(43-28-30-50-47(34-43)45-16-7-8-17-48(45)55(50)40-26-21-36(2)22-27-40)41-13-10-14-42(33-41)56-49-18-9-6-15-44(49)46-29-23-37-31-32-53(51(37)52(46)56)38-11-4-3-5-12-38/h3-34H,1-2H3 |
| InChIKey | UTDPOVKYLFACFY-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 18.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | 1300 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.90 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |