About [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate
[(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate (PubChem CID 11831669) has the molecular formula C14H28O3
and a molecular weight of 244.37 g/mol. Its IUPAC name is [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate |
| PubChem CID | 11831669 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate |
| SMILES | CCCCC[C@@H](OC(=O)C(C)(C)C)[C@H](C)CO |
| InChI | InChI=1S/C14H28O3/c1-6-7-8-9-12(11(2)10-15)17-13(16)14(3,4)5/h11-12,15H,6-10H2,1-5H3/t11-,12-/m1/s1 |
| InChIKey | BOAQPPFLPRECMA-VXGBXAGGSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate?
The IUPAC name of [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate (CID 11831669) is [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate is CCCCC[C@@H](OC(=O)C(C)(C)C)[C@H](C)CO.
What is the InChIKey of [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate?
The InChIKey is BOAQPPFLPRECMA-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H28O3/c1-6-7-8-9-12(11(2)10-15)17-13(16)14(3,4)5/h11-12,15H,6-10H2,1-5H3/t11-,12-/m1/s1.
What are the key properties of [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate?
[(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate has a molecular weight of 244.37 g/mol, XLogP of 3.15, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-1-hydroxy-2-methyloctan-3-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 11831669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).