C20H32N2O3 — CID 118318654
methyl 2-[5-amino-2-methoxy-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]acetate (PubChem CID 118318654) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is methyl 2-[5-amino-2-methoxy-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]acetate.
| Compound Name | methyl 2-[5-amino-2-methoxy-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 118318654 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | methyl 2-[5-amino-2-methoxy-4-[(3,3,5,5-tetramethylcyclohexyl)amino]phenyl]acetate |
| SMILES | COC(=O)Cc1cc(N)c(NC2CC(C)(C)CC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C20H32N2O3/c1-19(2)10-14(11-20(3,4)12-19)22-16-9-17(24-5)13(7-15(16)21)8-18(23)25-6/h7,9,14,22H,8,10-12,21H2,1-6H3 |
| InChIKey | KYCJXWYKECKJST-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|