C13H19NO4 — CID 11831943
ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-dihydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate (PubChem CID 11831943) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-dihydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate.
| Compound Name | ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-dihydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11831943 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | ethyl (5Z,6S,7S,7aS)-5-ethylidene-6,7-dihydroxy-3,6,7,7a-tetrahydro-2H-cyclopenta[b]pyridine-1-carboxylate |
| SMILES | C/C=C1/C2=CCCN(C(=O)OCC)[C@@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19NO4/c1-3-8-9-6-5-7-14(13(17)18-4-2)10(9)12(16)11(8)15/h3,6,10-12,15-16H,4-5,7H2,1-2H3/b8-3-/t10-,11-,12-/m0/s1 |
| InChIKey | KEFRJTFAGKIKDM-PNXMJJCVSA-N |
| XLogP | 0.83 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |