C17H21NO — CID 11832012
1-benzyl-3,3-dimethyl-3a,4,5,6-tetrahydroindol-2-one (PubChem CID 11832012) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-benzyl-3,3-dimethyl-3a,4,5,6-tetrahydroindol-2-one.
| Compound Name | 1-benzyl-3,3-dimethyl-3a,4,5,6-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 11832012 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-benzyl-3,3-dimethyl-3a,4,5,6-tetrahydroindol-2-one |
| SMILES | CC1(C)C(=O)N(Cc2ccccc2)C2=CCCCC21 |
| InChI | InChI=1S/C17H21NO/c1-17(2)14-10-6-7-11-15(14)18(16(17)19)12-13-8-4-3-5-9-13/h3-5,8-9,11,14H,6-7,10,12H2,1-2H3 |
| InChIKey | VTZRSCWFPHQHMD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |