C18H27N5O2 — CID 118320319
1-[(2S)-4-(cyclopropanecarbonyl)-6-[1-hydrazinyl-2-(methylamino)ethyl]-2-methyl-2,3-dihydroquinoxalin-1-yl]ethanone (PubChem CID 118320319) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[(2S)-4-(cyclopropanecarbonyl)-6-[1-hydrazinyl-2-(methylamino)ethyl]-2-methyl-2,3-dihydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-4-(cyclopropanecarbonyl)-6-[1-hydrazinyl-2-(methylamino)ethyl]-2-methyl-2,3-dihydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 118320319 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[(2S)-4-(cyclopropanecarbonyl)-6-[1-hydrazinyl-2-(methylamino)ethyl]-2-methyl-2,3-dihydroquinoxalin-1-yl]ethanone |
| SMILES | CNCC(NN)c1ccc2c(c1)N(C(=O)C1CC1)C[C@H](C)N2C(C)=O |
| InChI | InChI=1S/C18H27N5O2/c1-11-10-22(18(25)13-4-5-13)17-8-14(15(21-19)9-20-3)6-7-16(17)23(11)12(2)24/h6-8,11,13,15,20-21H,4-5,9-10,19H2,1-3H3/t11-,15?/m0/s1 |
| InChIKey | KGLBBFPBAQDGOR-VPHXOMNUSA-N |
| XLogP | 0.91 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|