C10H16IN3 — CID 118320487
(4S,6R)-5-(iodomethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-ene (PubChem CID 118320487) has the molecular formula C10H16IN3 and a molecular weight of 305.16 g/mol. Its IUPAC name is (4S,6R)-5-(iodomethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-ene.
| Compound Name | (4S,6R)-5-(iodomethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-ene |
|---|---|
| PubChem CID | 118320487 |
| Molecular Formula | C10H16IN3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (4S,6R)-5-(iodomethyl)-10,11,12-triazatricyclo[7.3.0.04,6]dodec-1(9)-ene |
| SMILES | ICC1[C@H]2CCC3=C(CC[C@@H]12)NNN3 |
| InChI | InChI=1S/C10H16IN3/c11-5-8-6-1-3-9-10(13-14-12-9)4-2-7(6)8/h6-8,12-14H,1-5H2/t6-,7+,8? |
| InChIKey | PNJBJIIEODBAQB-DHBOJHSNSA-N |
| XLogP | 1.68 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|