C22H20F4N6O2 — CID 118320583
6-(3,5-difluoro-4-morpholin-4-ylanilino)-4-[(2,3-difluorophenyl)methylamino]pyridazine-3-carboxamide (PubChem CID 118320583) has the molecular formula C22H20F4N6O2 and a molecular weight of 476.43 g/mol. Its IUPAC name is 6-(3,5-difluoro-4-morpholin-4-ylanilino)-4-[(2,3-difluorophenyl)methylamino]pyridazine-3-carboxamide.
| Compound Name | 6-(3,5-difluoro-4-morpholin-4-ylanilino)-4-[(2,3-difluorophenyl)methylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 118320583 |
| Molecular Formula | C22H20F4N6O2 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 6-(3,5-difluoro-4-morpholin-4-ylanilino)-4-[(2,3-difluorophenyl)methylamino]pyridazine-3-carboxamide |
| SMILES | NC(=O)c1nnc(Nc2cc(F)c(N3CCOCC3)c(F)c2)cc1NCc1cccc(F)c1F |
| InChI | InChI=1S/C22H20F4N6O2/c23-14-3-1-2-12(19(14)26)11-28-17-10-18(30-31-20(17)22(27)33)29-13-8-15(24)21(16(25)9-13)32-4-6-34-7-5-32/h1-3,8-10H,4-7,11H2,(H2,27,33)(H2,28,29,30) |
| InChIKey | GIPLEHMLSNMONJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|