About 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide
4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide (PubChem CID 118320591) has the molecular formula C22H22F2N6O2
and a molecular weight of 440.45 g/mol. Its IUPAC name is 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide |
| PubChem CID | 118320591 |
| Molecular Formula | C22H22F2N6O2 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide |
| SMILES | NC(=O)c1nnc(Nc2ccc(N3CCOCC3)cc2)cc1NCc1cccc(F)c1F |
| InChI | InChI=1S/C22H22F2N6O2/c23-17-3-1-2-14(20(17)24)13-26-18-12-19(28-29-21(18)22(25)31)27-15-4-6-16(7-5-15)30-8-10-32-11-9-30/h1-7,12H,8-11,13H2,(H2,25,31)(H2,26,27,28) |
| InChIKey | QLSICQDYYQMYEI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide?
The IUPAC name of 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide (CID 118320591) is 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide.
What is the SMILES notation for 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide?
The canonical SMILES for 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide is NC(=O)c1nnc(Nc2ccc(N3CCOCC3)cc2)cc1NCc1cccc(F)c1F.
What is the InChIKey of 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide?
The InChIKey is QLSICQDYYQMYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F2N6O2/c23-17-3-1-2-14(20(17)24)13-26-18-12-19(28-29-21(18)22(25)31)27-15-4-6-16(7-5-15)30-8-10-32-11-9-30/h1-7,12H,8-11,13H2,(H2,25,31)(H2,26,27,28).
What are the key properties of 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide?
4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide has a molecular weight of 440.45 g/mol, XLogP of 3.05, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,3-difluorophenyl)methylamino]-6-(4-morpholin-4-ylanilino)pyridazine-3-carboxamide is sourced from PubChem (CID 118320591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).