C14H24N4O3 — CID 118320837
N-[(1R,2R,6S)-6-azido-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 118320837) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[(1R,2R,6S)-6-azido-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2R,6S)-6-azido-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 118320837 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | N-[(1R,2R,6S)-6-azido-4-(hydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)O[C@@H]1C=C(CO)C[C@H](N=[N+]=[N-])[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H24N4O3/c1-4-11(5-2)21-13-7-10(8-19)6-12(17-18-15)14(13)16-9(3)20/h7,11-14,19H,4-6,8H2,1-3H3,(H,16,20)/t12-,13+,14+/m0/s1 |
| InChIKey | OBOCNSBGXGDAFX-BFHYXJOUSA-N |
| XLogP | 2.07 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|