C19H27N5O3S — CID 118320872
1-[(1R,2R,6S)-6-azido-2-pentan-3-yloxy-4-(thiophene-2-carbonyl)cyclohex-3-en-1-yl]-3-ethylurea (PubChem CID 118320872) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[(1R,2R,6S)-6-azido-2-pentan-3-yloxy-4-(thiophene-2-carbonyl)cyclohex-3-en-1-yl]-3-ethylurea.
| Compound Name | 1-[(1R,2R,6S)-6-azido-2-pentan-3-yloxy-4-(thiophene-2-carbonyl)cyclohex-3-en-1-yl]-3-ethylurea |
|---|---|
| PubChem CID | 118320872 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-[(1R,2R,6S)-6-azido-2-pentan-3-yloxy-4-(thiophene-2-carbonyl)cyclohex-3-en-1-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@@H]1[C@@H](N=[N+]=[N-])CC(C(=O)c2cccs2)=C[C@H]1OC(CC)CC |
| InChI | InChI=1S/C19H27N5O3S/c1-4-13(5-2)27-15-11-12(18(25)16-8-7-9-28-16)10-14(23-24-20)17(15)22-19(26)21-6-3/h7-9,11,13-15,17H,4-6,10H2,1-3H3,(H2,21,22,26)/t14-,15+,17+/m0/s1 |
| InChIKey | BSHRJCNMQIZNSJ-ZMSDIMECSA-N |
| XLogP | 4.20 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|