About methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate
methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate (PubChem CID 11832193) has the molecular formula C16H23NO2
and a molecular weight of 261.36 g/mol. Its IUPAC name is methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate.
Molecular Properties
| Compound Name | methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate |
| PubChem CID | 11832193 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate |
| SMILES | COC(=O)c1ccc2nc1CCCCCCCCC2 |
| InChI | InChI=1S/C16H23NO2/c1-19-16(18)14-12-11-13-9-7-5-3-2-4-6-8-10-15(14)17-13/h11-12H,2-10H2,1H3 |
| InChIKey | VHTKFRPYPASAFW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate?
The IUPAC name of methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate (CID 11832193) is methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate.
What is the SMILES notation for methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate?
The canonical SMILES for methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate is COC(=O)c1ccc2nc1CCCCCCCCC2.
What is the InChIKey of methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate?
The InChIKey is VHTKFRPYPASAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-19-16(18)14-12-11-13-9-7-5-3-2-4-6-8-10-15(14)17-13/h11-12H,2-10H2,1H3.
What are the key properties of methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate?
methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate has a molecular weight of 261.36 g/mol, XLogP of 3.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 15-azabicyclo[9.3.1]pentadeca-1(15),11,13-triene-12-carboxylate is sourced from PubChem (CID 11832193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).