C25H21ClF5N3O6S — CID 118322266
[3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate (PubChem CID 118322266) has the molecular formula C25H21ClF5N3O6S and a molecular weight of 621.97 g/mol. Its IUPAC name is [3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate.
| Compound Name | [3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118322266 |
| Molecular Formula | C25H21ClF5N3O6S |
| Molecular Weight | 621.97 g/mol |
| Exact Mass | 621.08 |
| IUPAC Name | [3-acetyl-1-[2-[(2S,4R)-2-[(3-chloro-2-fluorophenyl)methylcarbamoyl]-4-fluoropyrrolidin-1-yl]-2-oxoethyl]indol-6-yl] trifluoromethanesulfonate |
| SMILES | CC(=O)c1cn(CC(=O)N2C[C@H](F)C[C@H]2C(=O)NCc2cccc(Cl)c2F)c2cc(OS(=O)(=O)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C25H21ClF5N3O6S/c1-13(35)18-11-33(20-8-16(5-6-17(18)20)40-41(38,39)25(29,30)31)12-22(36)34-10-15(27)7-21(34)24(37)32-9-14-3-2-4-19(26)23(14)28/h2-6,8,11,15,21H,7,9-10,12H2,1H3,(H,32,37)/t15-,21+/m1/s1 |
| InChIKey | CMXWFFDMFCHMOV-VFNWGFHPSA-N |
| XLogP | 4.12 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.97 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|